C25H30FNO4 — CID 59031531
(Z)-3-[4-[4-(cyclohexylamino)phenyl]-2,5-dimethoxy-3,6-dimethylphenyl]-2-fluoroprop-2-enoic acid (PubChem CID 59031531) has the molecular formula C25H30FNO4 and a molecular weight of 427.52 g/mol. Its IUPAC name is (Z)-3-[4-[4-(cyclohexylamino)phenyl]-2,5-dimethoxy-3,6-dimethylphenyl]-2-fluoroprop-2-enoic acid.
| Compound Name | (Z)-3-[4-[4-(cyclohexylamino)phenyl]-2,5-dimethoxy-3,6-dimethylphenyl]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 59031531 |
| Molecular Formula | C25H30FNO4 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | (Z)-3-[4-[4-(cyclohexylamino)phenyl]-2,5-dimethoxy-3,6-dimethylphenyl]-2-fluoroprop-2-enoic acid |
| SMILES | COc1c(C)c(-c2ccc(NC3CCCCC3)cc2)c(OC)c(C)c1/C=C(\F)C(=O)O |
| InChI | InChI=1S/C25H30FNO4/c1-15-20(14-21(26)25(28)29)23(30-3)16(2)22(24(15)31-4)17-10-12-19(13-11-17)27-18-8-6-5-7-9-18/h10-14,18,27H,5-9H2,1-4H3,(H,28,29)/b21-14- |
| InChIKey | TVRPYLFIANUOTF-STZFKDTASA-N |
| XLogP | 6.13 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|