C25H22F4N2O4 — CID 59031642
2-[[(E)-2-methyl-3-[2,3,5,6-tetrafluoro-4-[4-[(5-methylfuran-2-yl)methylamino]phenyl]phenyl]prop-2-enoyl]amino]propanoic acid (PubChem CID 59031642) has the molecular formula C25H22F4N2O4 and a molecular weight of 490.45 g/mol. Its IUPAC name is 2-[[(E)-2-methyl-3-[2,3,5,6-tetrafluoro-4-[4-[(5-methylfuran-2-yl)methylamino]phenyl]phenyl]prop-2-enoyl]amino]propanoic acid.
| Compound Name | 2-[[(E)-2-methyl-3-[2,3,5,6-tetrafluoro-4-[4-[(5-methylfuran-2-yl)methylamino]phenyl]phenyl]prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 59031642 |
| Molecular Formula | C25H22F4N2O4 |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 2-[[(E)-2-methyl-3-[2,3,5,6-tetrafluoro-4-[4-[(5-methylfuran-2-yl)methylamino]phenyl]phenyl]prop-2-enoyl]amino]propanoic acid |
| SMILES | C/C(=C\c1c(F)c(F)c(-c2ccc(NCc3ccc(C)o3)cc2)c(F)c1F)C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C25H22F4N2O4/c1-12(24(32)31-14(3)25(33)34)10-18-20(26)22(28)19(23(29)21(18)27)15-5-7-16(8-6-15)30-11-17-9-4-13(2)35-17/h4-10,14,30H,11H2,1-3H3,(H,31,32)(H,33,34)/b12-10+ |
| InChIKey | ONKPSZVMFIUUAP-ZRDIBKRKSA-N |
| XLogP | 5.42 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|