C27H42N4O5 — CID 59032136
(2R)-N-[(3S)-2,9-dioxo-1,8-diazacyclotetradec-3-yl]-2-[[formyl(phenylmethoxy)amino]methyl]hexanamide (PubChem CID 59032136) has the molecular formula C27H42N4O5 and a molecular weight of 502.66 g/mol. Its IUPAC name is (2R)-N-[(3S)-2,9-dioxo-1,8-diazacyclotetradec-3-yl]-2-[[formyl(phenylmethoxy)amino]methyl]hexanamide.
| Compound Name | (2R)-N-[(3S)-2,9-dioxo-1,8-diazacyclotetradec-3-yl]-2-[[formyl(phenylmethoxy)amino]methyl]hexanamide |
|---|---|
| PubChem CID | 59032136 |
| Molecular Formula | C27H42N4O5 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.32 |
| IUPAC Name | (2R)-N-[(3S)-2,9-dioxo-1,8-diazacyclotetradec-3-yl]-2-[[formyl(phenylmethoxy)amino]methyl]hexanamide |
| SMILES | CCCC[C@H](CN(C=O)OCc1ccccc1)C(=O)N[C@H]1CCCCNC(=O)CCCCCNC1=O |
| InChI | InChI=1S/C27H42N4O5/c1-2-3-14-23(19-31(21-32)36-20-22-12-6-4-7-13-22)26(34)30-24-15-9-11-17-28-25(33)16-8-5-10-18-29-27(24)35/h4,6-7,12-13,21,23-24H,2-3,5,8-11,14-20H2,1H3,(H,28,33)(H,29,35)(H,30,34)/t23-,24+/m1/s1 |
| InChIKey | DKZZPLAUMJEDBM-RPWUZVMVSA-N |
| XLogP | 2.84 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|