C25H35NO2Si — CID 59032177
(3S,5R,6R)-3,6-dibenzyl-5-[tert-butyl(dimethyl)silyl]oxypiperidin-2-one (PubChem CID 59032177) has the molecular formula C25H35NO2Si and a molecular weight of 409.65 g/mol. Its IUPAC name is (3S,5R,6R)-3,6-dibenzyl-5-[tert-butyl(dimethyl)silyl]oxypiperidin-2-one.
| Compound Name | (3S,5R,6R)-3,6-dibenzyl-5-[tert-butyl(dimethyl)silyl]oxypiperidin-2-one |
|---|---|
| PubChem CID | 59032177 |
| Molecular Formula | C25H35NO2Si |
| Molecular Weight | 409.65 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | (3S,5R,6R)-3,6-dibenzyl-5-[tert-butyl(dimethyl)silyl]oxypiperidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@H](Cc2ccccc2)C(=O)N[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C25H35NO2Si/c1-25(2,3)29(4,5)28-23-18-21(16-19-12-8-6-9-13-19)24(27)26-22(23)17-20-14-10-7-11-15-20/h6-15,21-23H,16-18H2,1-5H3,(H,26,27)/t21-,22+,23+/m0/s1 |
| InChIKey | DRXXXJUYESPDJZ-YTFSRNRJSA-N |
| XLogP | 5.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.65 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|