C36H34N4O2 — CID 59032237
2-isocyano-2-[(4R,5S,6S,7R)-1,3,4,7-tetrabenzyl-5,6-dihydroxy-1,3-diazepan-2-ylidene]acetonitrile (PubChem CID 59032237) has the molecular formula C36H34N4O2 and a molecular weight of 554.69 g/mol. Its IUPAC name is 2-isocyano-2-[(4R,5S,6S,7R)-1,3,4,7-tetrabenzyl-5,6-dihydroxy-1,3-diazepan-2-ylidene]acetonitrile.
| Compound Name | 2-isocyano-2-[(4R,5S,6S,7R)-1,3,4,7-tetrabenzyl-5,6-dihydroxy-1,3-diazepan-2-ylidene]acetonitrile |
|---|---|
| PubChem CID | 59032237 |
| Molecular Formula | C36H34N4O2 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | 2-isocyano-2-[(4R,5S,6S,7R)-1,3,4,7-tetrabenzyl-5,6-dihydroxy-1,3-diazepan-2-ylidene]acetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1N(Cc2ccccc2)[C@H](Cc2ccccc2)[C@H](O)[C@@H](O)[C@@H](Cc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C36H34N4O2/c1-38-31(24-37)36-39(25-29-18-10-4-11-19-29)32(22-27-14-6-2-7-15-27)34(41)35(42)33(23-28-16-8-3-9-17-28)40(36)26-30-20-12-5-13-21-30/h2-21,32-35,41-42H,22-23,25-26H2/t32-,33-,34+,35+/m1/s1 |
| InChIKey | KNZXMTHOBPLNNR-WDKGQIBQSA-N |
| XLogP | 5.56 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|