About [(1R,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl] 3-cyclopropylpropanoate
[(1R,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl] 3-cyclopropylpropanoate (PubChem CID 59032248) has the molecular formula C16H20O2
and a molecular weight of 244.33 g/mol. Its IUPAC name is [(1R,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl] 3-cyclopropylpropanoate.
Molecular Properties
| Compound Name | [(1R,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl] 3-cyclopropylpropanoate |
| PubChem CID | 59032248 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | [(1R,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl] 3-cyclopropylpropanoate |
| SMILES | C[C@@H]1c2ccccc2C[C@@H]1OC(=O)CCC1CC1 |
| InChI | InChI=1S/C16H20O2/c1-11-14-5-3-2-4-13(14)10-15(11)18-16(17)9-8-12-6-7-12/h2-5,11-12,15H,6-10H2,1H3/t11-,15+/m1/s1 |
| InChIKey | VDCGRTOTDSLQQN-ABAIWWIYSA-N |
| XLogP | 3.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1R,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl] 3-cyclopropylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl] 3-cyclopropylpropanoate?
The IUPAC name of [(1R,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl] 3-cyclopropylpropanoate (CID 59032248) is [(1R,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl] 3-cyclopropylpropanoate.
What is the SMILES notation for [(1R,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl] 3-cyclopropylpropanoate?
The canonical SMILES for [(1R,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl] 3-cyclopropylpropanoate is C[C@@H]1c2ccccc2C[C@@H]1OC(=O)CCC1CC1.
What is the InChIKey of [(1R,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl] 3-cyclopropylpropanoate?
The InChIKey is VDCGRTOTDSLQQN-ABAIWWIYSA-N. The full InChI is InChI=1S/C16H20O2/c1-11-14-5-3-2-4-13(14)10-15(11)18-16(17)9-8-12-6-7-12/h2-5,11-12,15H,6-10H2,1H3/t11-,15+/m1/s1.
What are the key properties of [(1R,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl] 3-cyclopropylpropanoate?
[(1R,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl] 3-cyclopropylpropanoate has a molecular weight of 244.33 g/mol, XLogP of 3.45, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl] 3-cyclopropylpropanoate is sourced from PubChem (CID 59032248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).