About CID 59032326
CID 59032326 (PubChem CID 59032326) has the molecular formula C13H27N2O3
and a molecular weight of 259.37 g/mol.
Molecular Properties
| Compound Name | CID 59032326 |
| PubChem CID | 59032326 |
| Molecular Formula | C13H27N2O3 |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(N(CCO)CCO)CC(C)(C)N1[O] |
| InChI | InChI=1S/C13H27N2O3/c1-12(2)9-11(10-13(3,4)15(12)18)14(5-7-16)6-8-17/h11,16-17H,5-10H2,1-4H3 |
| InChIKey | RWGISQGXOYYDEJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 59032326 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59032326?
The IUPAC name of CID 59032326 (CID 59032326) is not available.
What is the SMILES notation for CID 59032326?
The canonical SMILES for CID 59032326 is CC1(C)CC(N(CCO)CCO)CC(C)(C)N1[O].
What is the InChIKey of CID 59032326?
The InChIKey is RWGISQGXOYYDEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N2O3/c1-12(2)9-11(10-13(3,4)15(12)18)14(5-7-16)6-8-17/h11,16-17H,5-10H2,1-4H3.
What are the key properties of CID 59032326?
CID 59032326 has a molecular weight of 259.37 g/mol, XLogP of 0.64, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59032326 is sourced from PubChem (CID 59032326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).