About ditert-butyl (2S)-2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate
ditert-butyl (2S)-2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate (PubChem CID 59032633) has the molecular formula C18H27N3O7
and a molecular weight of 397.43 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate.
Molecular Properties
| Compound Name | ditert-butyl (2S)-2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate |
| PubChem CID | 59032633 |
| Molecular Formula | C18H27N3O7 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | ditert-butyl (2S)-2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate |
| SMILES | CC(C)(C)OC(=O)C[C@H](NC(=O)Cn1ccc(=O)[nH]c1=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27N3O7/c1-17(2,3)27-14(24)9-11(15(25)28-18(4,5)6)19-13(23)10-21-8-7-12(22)20-16(21)26/h7-8,11H,9-10H2,1-6H3,(H,19,23)(H,20,22,26)/t11-/m0/s1 |
| InChIKey | WYBWDEFHPLLIRQ-NSHDSACASA-N |
| XLogP | 0.09 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ditert-butyl (2S)-2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl (2S)-2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate?
The IUPAC name of ditert-butyl (2S)-2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate (CID 59032633) is ditert-butyl (2S)-2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate.
What is the SMILES notation for ditert-butyl (2S)-2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate?
The canonical SMILES for ditert-butyl (2S)-2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate is CC(C)(C)OC(=O)C[C@H](NC(=O)Cn1ccc(=O)[nH]c1=O)C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl (2S)-2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate?
The InChIKey is WYBWDEFHPLLIRQ-NSHDSACASA-N. The full InChI is InChI=1S/C18H27N3O7/c1-17(2,3)27-14(24)9-11(15(25)28-18(4,5)6)19-13(23)10-21-8-7-12(22)20-16(21)26/h7-8,11H,9-10H2,1-6H3,(H,19,23)(H,20,22,26)/t11-/m0/s1.
What are the key properties of ditert-butyl (2S)-2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate?
ditert-butyl (2S)-2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate has a molecular weight of 397.43 g/mol, XLogP of 0.09, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl (2S)-2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]butanedioate is sourced from PubChem (CID 59032633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).