C24H21ClF2O2 — CID 59032878
(E)-3-(4-chlorophenyl)-4,5-difluoro-6-(3-phenoxyphenyl)hex-4-en-1-ol (PubChem CID 59032878) has the molecular formula C24H21ClF2O2 and a molecular weight of 414.88 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-4,5-difluoro-6-(3-phenoxyphenyl)hex-4-en-1-ol.
| Compound Name | (E)-3-(4-chlorophenyl)-4,5-difluoro-6-(3-phenoxyphenyl)hex-4-en-1-ol |
|---|---|
| PubChem CID | 59032878 |
| Molecular Formula | C24H21ClF2O2 |
| Molecular Weight | 414.88 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-4,5-difluoro-6-(3-phenoxyphenyl)hex-4-en-1-ol |
| SMILES | OCCC(/C(F)=C(\F)Cc1cccc(Oc2ccccc2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H21ClF2O2/c25-19-11-9-18(10-12-19)22(13-14-28)24(27)23(26)16-17-5-4-8-21(15-17)29-20-6-2-1-3-7-20/h1-12,15,22,28H,13-14,16H2/b24-23+ |
| InChIKey | FOEGTLNLIZNUHO-WCWDXBQESA-N |
| XLogP | 6.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.88 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |