About methyl 2-[methyl-[(3S,4S)-3-methyl-4-[(4-methylpiperidin-1-yl)methyl]cyclopentyl]amino]propanoate
methyl 2-[methyl-[(3S,4S)-3-methyl-4-[(4-methylpiperidin-1-yl)methyl]cyclopentyl]amino]propanoate (PubChem CID 59033018) has the molecular formula C18H34N2O2
and a molecular weight of 310.48 g/mol. Its IUPAC name is methyl 2-[methyl-[(3S,4S)-3-methyl-4-[(4-methylpiperidin-1-yl)methyl]cyclopentyl]amino]propanoate.
Molecular Properties
| Compound Name | methyl 2-[methyl-[(3S,4S)-3-methyl-4-[(4-methylpiperidin-1-yl)methyl]cyclopentyl]amino]propanoate |
| PubChem CID | 59033018 |
| Molecular Formula | C18H34N2O2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.26 |
| IUPAC Name | methyl 2-[methyl-[(3S,4S)-3-methyl-4-[(4-methylpiperidin-1-yl)methyl]cyclopentyl]amino]propanoate |
| SMILES | COC(=O)C(C)N(C)C1C[C@H](CN2CCC(C)CC2)[C@@H](C)C1 |
| InChI | InChI=1S/C18H34N2O2/c1-13-6-8-20(9-7-13)12-16-11-17(10-14(16)2)19(4)15(3)18(21)22-5/h13-17H,6-12H2,1-5H3/t14-,15?,16+,17?/m0/s1 |
| InChIKey | LGJIYRSFLWSVNM-ORBLRFAASA-N |
| XLogP | 2.63 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[methyl-[(3S,4S)-3-methyl-4-[(4-methylpiperidin-1-yl)methyl]cyclopentyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[methyl-[(3S,4S)-3-methyl-4-[(4-methylpiperidin-1-yl)methyl]cyclopentyl]amino]propanoate?
The IUPAC name of methyl 2-[methyl-[(3S,4S)-3-methyl-4-[(4-methylpiperidin-1-yl)methyl]cyclopentyl]amino]propanoate (CID 59033018) is methyl 2-[methyl-[(3S,4S)-3-methyl-4-[(4-methylpiperidin-1-yl)methyl]cyclopentyl]amino]propanoate.
What is the SMILES notation for methyl 2-[methyl-[(3S,4S)-3-methyl-4-[(4-methylpiperidin-1-yl)methyl]cyclopentyl]amino]propanoate?
The canonical SMILES for methyl 2-[methyl-[(3S,4S)-3-methyl-4-[(4-methylpiperidin-1-yl)methyl]cyclopentyl]amino]propanoate is COC(=O)C(C)N(C)C1C[C@H](CN2CCC(C)CC2)[C@@H](C)C1.
What is the InChIKey of methyl 2-[methyl-[(3S,4S)-3-methyl-4-[(4-methylpiperidin-1-yl)methyl]cyclopentyl]amino]propanoate?
The InChIKey is LGJIYRSFLWSVNM-ORBLRFAASA-N. The full InChI is InChI=1S/C18H34N2O2/c1-13-6-8-20(9-7-13)12-16-11-17(10-14(16)2)19(4)15(3)18(21)22-5/h13-17H,6-12H2,1-5H3/t14-,15?,16+,17?/m0/s1.
What are the key properties of methyl 2-[methyl-[(3S,4S)-3-methyl-4-[(4-methylpiperidin-1-yl)methyl]cyclopentyl]amino]propanoate?
methyl 2-[methyl-[(3S,4S)-3-methyl-4-[(4-methylpiperidin-1-yl)methyl]cyclopentyl]amino]propanoate has a molecular weight of 310.48 g/mol, XLogP of 2.63, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[methyl-[(3S,4S)-3-methyl-4-[(4-methylpiperidin-1-yl)methyl]cyclopentyl]amino]propanoate is sourced from PubChem (CID 59033018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).