C23H38O3 — CID 59033091
(1S,3R,7S,8S,8aR)-8-[2-[(4R,6S)-2,2-dimethyl-6-propyl-1,3-dioxan-4-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol (PubChem CID 59033091) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is (1S,3R,7S,8S,8aR)-8-[2-[(4R,6S)-2,2-dimethyl-6-propyl-1,3-dioxan-4-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol.
| Compound Name | (1S,3R,7S,8S,8aR)-8-[2-[(4R,6S)-2,2-dimethyl-6-propyl-1,3-dioxan-4-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 59033091 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | (1S,3R,7S,8S,8aR)-8-[2-[(4R,6S)-2,2-dimethyl-6-propyl-1,3-dioxan-4-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol |
| SMILES | CCC[C@H]1C[C@@H](CC[C@@H]2[C@@H]3C(=C[C@H](C)C[C@@H]3O)C=C[C@@H]2C)OC(C)(C)O1 |
| InChI | InChI=1S/C23H38O3/c1-6-7-18-14-19(26-23(4,5)25-18)10-11-20-16(3)8-9-17-12-15(2)13-21(24)22(17)20/h8-9,12,15-16,18-22,24H,6-7,10-11,13-14H2,1-5H3/t15-,16-,18-,19+,20-,21-,22-/m0/s1 |
| InChIKey | JCFHWDUFUUMLGA-SOWWUCBVSA-N |
| XLogP | 5.24 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |