C11H18INO3 — CID 59033116
[4-[(E)-1-hydroxy-3-iodoprop-2-enyl]-1-(114C)methylpiperidin-3-yl] acetate (PubChem CID 59033116) has the molecular formula C11H18INO3 and a molecular weight of 341.17 g/mol. Its IUPAC name is [4-[(E)-1-hydroxy-3-iodoprop-2-enyl]-1-(114C)methylpiperidin-3-yl] acetate.
| Compound Name | [4-[(E)-1-hydroxy-3-iodoprop-2-enyl]-1-(114C)methylpiperidin-3-yl] acetate |
|---|---|
| PubChem CID | 59033116 |
| Molecular Formula | C11H18INO3 |
| Molecular Weight | 341.17 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | [4-[(E)-1-hydroxy-3-iodoprop-2-enyl]-1-(114C)methylpiperidin-3-yl] acetate |
| SMILES | CC(=O)OC1CN([14CH3])CCC1C(O)/C=C/I |
| InChI | InChI=1S/C11H18INO3/c1-8(14)16-11-7-13(2)6-4-9(11)10(15)3-5-12/h3,5,9-11,15H,4,6-7H2,1-2H3/b5-3+/i2+2 |
| InChIKey | BUFMURKUSDASER-FHRJXESESA-N |
| XLogP | 1.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.17 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|