C34H39N3O3 — CID 59033335
3-[4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]-4-phenylmethoxybenzonitrile (PubChem CID 59033335) has the molecular formula C34H39N3O3 and a molecular weight of 537.70 g/mol. Its IUPAC name is 3-[4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]-4-phenylmethoxybenzonitrile.
| Compound Name | 3-[4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]-4-phenylmethoxybenzonitrile |
|---|---|
| PubChem CID | 59033335 |
| Molecular Formula | C34H39N3O3 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | 3-[4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]-4-phenylmethoxybenzonitrile |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCCCCN1C(=O)C(c2cc(C#N)ccc2OCc2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C34H39N3O3/c1-25-12-11-13-26(2)36(25)20-9-4-10-21-37-30-16-7-8-17-32(30)40-33(34(37)38)29-22-28(23-35)18-19-31(29)39-24-27-14-5-3-6-15-27/h3,5-8,14-19,22,25-26,33H,4,9-13,20-21,24H2,1-2H3/t25-,26+,33? |
| InChIKey | GGEKARDCESVGNJ-VQCVFUCLSA-N |
| XLogP | 7.04 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|