About 3-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]-4-phenylmethoxybenzonitrile
3-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]-4-phenylmethoxybenzonitrile (PubChem CID 59033339) has the molecular formula C22H16N2O3
and a molecular weight of 356.38 g/mol. Its IUPAC name is 3-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]-4-phenylmethoxybenzonitrile.
Molecular Properties
| Compound Name | 3-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]-4-phenylmethoxybenzonitrile |
| PubChem CID | 59033339 |
| Molecular Formula | C22H16N2O3 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 3-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]-4-phenylmethoxybenzonitrile |
| SMILES | N#Cc1ccc(OCc2ccccc2)c([C@@H]2Oc3ccccc3NC2=O)c1 |
| InChI | InChI=1S/C22H16N2O3/c23-13-16-10-11-19(26-14-15-6-2-1-3-7-15)17(12-16)21-22(25)24-18-8-4-5-9-20(18)27-21/h1-12,21H,14H2,(H,24,25)/t21-/m0/s1 |
| InChIKey | KIOUHHGSEXJYPM-NRFANRHFSA-N |
| XLogP | 4.21 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]-4-phenylmethoxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]-4-phenylmethoxybenzonitrile?
The IUPAC name of 3-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]-4-phenylmethoxybenzonitrile (CID 59033339) is 3-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]-4-phenylmethoxybenzonitrile.
What is the SMILES notation for 3-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]-4-phenylmethoxybenzonitrile?
The canonical SMILES for 3-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]-4-phenylmethoxybenzonitrile is N#Cc1ccc(OCc2ccccc2)c([C@@H]2Oc3ccccc3NC2=O)c1.
What is the InChIKey of 3-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]-4-phenylmethoxybenzonitrile?
The InChIKey is KIOUHHGSEXJYPM-NRFANRHFSA-N. The full InChI is InChI=1S/C22H16N2O3/c23-13-16-10-11-19(26-14-15-6-2-1-3-7-15)17(12-16)21-22(25)24-18-8-4-5-9-20(18)27-21/h1-12,21H,14H2,(H,24,25)/t21-/m0/s1.
What are the key properties of 3-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]-4-phenylmethoxybenzonitrile?
3-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]-4-phenylmethoxybenzonitrile has a molecular weight of 356.38 g/mol, XLogP of 4.21, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]-4-phenylmethoxybenzonitrile is sourced from PubChem (CID 59033339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).