C26H27N5O3S — CID 59033801
2-benzyl-1-[(2R,3R)-3-[(4-ethylphenyl)sulfonylamino]-2-hydroxy-2,3-dihydro-1H-inden-5-yl]-3-isocyanoguanidine (PubChem CID 59033801) has the molecular formula C26H27N5O3S and a molecular weight of 489.60 g/mol. Its IUPAC name is 2-benzyl-1-[(2R,3R)-3-[(4-ethylphenyl)sulfonylamino]-2-hydroxy-2,3-dihydro-1H-inden-5-yl]-3-isocyanoguanidine.
| Compound Name | 2-benzyl-1-[(2R,3R)-3-[(4-ethylphenyl)sulfonylamino]-2-hydroxy-2,3-dihydro-1H-inden-5-yl]-3-isocyanoguanidine |
|---|---|
| PubChem CID | 59033801 |
| Molecular Formula | C26H27N5O3S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 2-benzyl-1-[(2R,3R)-3-[(4-ethylphenyl)sulfonylamino]-2-hydroxy-2,3-dihydro-1H-inden-5-yl]-3-isocyanoguanidine |
| SMILES | [C-]#[N+]N/C(=N\Cc1ccccc1)Nc1ccc2c(c1)[C@@H](NS(=O)(=O)c1ccc(CC)cc1)[C@H](O)C2 |
| InChI | InChI=1S/C26H27N5O3S/c1-3-18-9-13-22(14-10-18)35(33,34)31-25-23-16-21(12-11-20(23)15-24(25)32)29-26(30-27-2)28-17-19-7-5-4-6-8-19/h4-14,16,24-25,31-32H,3,15,17H2,1H3,(H2,28,29,30)/t24-,25-/m1/s1 |
| InChIKey | HAUSLNRUUFOTHN-JWQCQUIFSA-N |
| XLogP | 3.58 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|