C23H18N2O2S — CID 59034525
3-benzyl-1-methyl-6-(3-phenylprop-1-ynyl)thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 59034525) has the molecular formula C23H18N2O2S and a molecular weight of 386.48 g/mol. Its IUPAC name is 3-benzyl-1-methyl-6-(3-phenylprop-1-ynyl)thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-benzyl-1-methyl-6-(3-phenylprop-1-ynyl)thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 59034525 |
| Molecular Formula | C23H18N2O2S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 3-benzyl-1-methyl-6-(3-phenylprop-1-ynyl)thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)n(Cc2ccccc2)c(=O)c2cc(C#CCc3ccccc3)sc21 |
| InChI | InChI=1S/C23H18N2O2S/c1-24-22-20(15-19(28-22)14-8-13-17-9-4-2-5-10-17)21(26)25(23(24)27)16-18-11-6-3-7-12-18/h2-7,9-12,15H,13,16H2,1H3 |
| InChIKey | OJQUBPATLHUPPS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|