About N-(2-isocyanoethyl)-N,5-dimethyl-1,3,4-thiadiazol-2-amine
N-(2-isocyanoethyl)-N,5-dimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 59034813) has the molecular formula C7H10N4S
and a molecular weight of 182.25 g/mol. Its IUPAC name is N-(2-isocyanoethyl)-N,5-dimethyl-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | N-(2-isocyanoethyl)-N,5-dimethyl-1,3,4-thiadiazol-2-amine |
| PubChem CID | 59034813 |
| Molecular Formula | C7H10N4S |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | N-(2-isocyanoethyl)-N,5-dimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | [C-]#[N+]CCN(C)c1nnc(C)s1 |
| InChI | InChI=1S/C7H10N4S/c1-6-9-10-7(12-6)11(3)5-4-8-2/h4-5H2,1,3H3 |
| InChIKey | FTEIWXPSMBQZSB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 33.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-(2-isocyanoethyl)-N,5-dimethyl-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-isocyanoethyl)-N,5-dimethyl-1,3,4-thiadiazol-2-amine?
The IUPAC name of N-(2-isocyanoethyl)-N,5-dimethyl-1,3,4-thiadiazol-2-amine (CID 59034813) is N-(2-isocyanoethyl)-N,5-dimethyl-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for N-(2-isocyanoethyl)-N,5-dimethyl-1,3,4-thiadiazol-2-amine?
The canonical SMILES for N-(2-isocyanoethyl)-N,5-dimethyl-1,3,4-thiadiazol-2-amine is [C-]#[N+]CCN(C)c1nnc(C)s1.
What is the InChIKey of N-(2-isocyanoethyl)-N,5-dimethyl-1,3,4-thiadiazol-2-amine?
The InChIKey is FTEIWXPSMBQZSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4S/c1-6-9-10-7(12-6)11(3)5-4-8-2/h4-5H2,1,3H3.
What are the key properties of N-(2-isocyanoethyl)-N,5-dimethyl-1,3,4-thiadiazol-2-amine?
N-(2-isocyanoethyl)-N,5-dimethyl-1,3,4-thiadiazol-2-amine has a molecular weight of 182.25 g/mol, XLogP of 1.20, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-isocyanoethyl)-N,5-dimethyl-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 59034813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).