C18H21N2O+ — CID 59035399
5-(4-methoxyphenyl)-2,3,3,7-tetramethylpyrrolo[2,3-b]pyridin-7-ium (PubChem CID 59035399) has the molecular formula C18H21N2O+ and a molecular weight of 281.38 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2,3,3,7-tetramethylpyrrolo[2,3-b]pyridin-7-ium.
| Compound Name | 5-(4-methoxyphenyl)-2,3,3,7-tetramethylpyrrolo[2,3-b]pyridin-7-ium |
|---|---|
| PubChem CID | 59035399 |
| Molecular Formula | C18H21N2O+ |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 5-(4-methoxyphenyl)-2,3,3,7-tetramethylpyrrolo[2,3-b]pyridin-7-ium |
| SMILES | COc1ccc(-c2cc3c([n+](C)c2)N=C(C)C3(C)C)cc1 |
| InChI | InChI=1S/C18H21N2O/c1-12-18(2,3)16-10-14(11-20(4)17(16)19-12)13-6-8-15(21-5)9-7-13/h6-11H,1-5H3/q+1 |
| InChIKey | KWLMWHUDEAYKON-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 25.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|