C27H39N5O7 — CID 59035539
tert-butyl N-[6-[[(2S,4S)-4-(4-amino-2-oxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methoxycarbonylamino]hexyl]-N-benzylcarbamate (PubChem CID 59035539) has the molecular formula C27H39N5O7 and a molecular weight of 545.64 g/mol. Its IUPAC name is tert-butyl N-[6-[[(2S,4S)-4-(4-amino-2-oxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methoxycarbonylamino]hexyl]-N-benzylcarbamate.
| Compound Name | tert-butyl N-[6-[[(2S,4S)-4-(4-amino-2-oxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methoxycarbonylamino]hexyl]-N-benzylcarbamate |
|---|---|
| PubChem CID | 59035539 |
| Molecular Formula | C27H39N5O7 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | tert-butyl N-[6-[[(2S,4S)-4-(4-amino-2-oxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methoxycarbonylamino]hexyl]-N-benzylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCCCCNC(=O)OC[C@H]1OC[C@@H](n2ccc(N)nc2=O)O1)Cc1ccccc1 |
| InChI | InChI=1S/C27H39N5O7/c1-27(2,3)39-26(35)31(17-20-11-7-6-8-12-20)15-10-5-4-9-14-29-25(34)37-19-23-36-18-22(38-23)32-16-13-21(28)30-24(32)33/h6-8,11-13,16,22-23H,4-5,9-10,14-15,17-19H2,1-3H3,(H,29,34)(H2,28,30,33)/t22-,23-/m0/s1 |
| InChIKey | WTGREFPUTDNJBZ-GOTSBHOMSA-N |
| XLogP | 3.42 |
| TPSA | 147.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|