C25H27N5O4 — CID 59035757
3-[(2S,4S)-4-[4-(dimethylaminomethylideneamino)-2-oxopyrimidin-1-yl]-1,3-dioxolan-2-yl]-N,N-diphenylpropanamide (PubChem CID 59035757) has the molecular formula C25H27N5O4 and a molecular weight of 461.52 g/mol. Its IUPAC name is 3-[(2S,4S)-4-[4-(dimethylaminomethylideneamino)-2-oxopyrimidin-1-yl]-1,3-dioxolan-2-yl]-N,N-diphenylpropanamide.
| Compound Name | 3-[(2S,4S)-4-[4-(dimethylaminomethylideneamino)-2-oxopyrimidin-1-yl]-1,3-dioxolan-2-yl]-N,N-diphenylpropanamide |
|---|---|
| PubChem CID | 59035757 |
| Molecular Formula | C25H27N5O4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 3-[(2S,4S)-4-[4-(dimethylaminomethylideneamino)-2-oxopyrimidin-1-yl]-1,3-dioxolan-2-yl]-N,N-diphenylpropanamide |
| SMILES | CN(C)/C=N/c1ccn([C@@H]2CO[C@H](CCC(=O)N(c3ccccc3)c3ccccc3)O2)c(=O)n1 |
| InChI | InChI=1S/C25H27N5O4/c1-28(2)18-26-21-15-16-29(25(32)27-21)23-17-33-24(34-23)14-13-22(31)30(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,15-16,18,23-24H,13-14,17H2,1-2H3/b26-18+/t23-,24-/m0/s1 |
| InChIKey | FUCSIMLKQXMWEL-LIMRUYCNSA-N |
| XLogP | 3.48 |
| TPSA | 89.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|