C23H35N3O — CID 59036105
N-[4-[(3R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]phenyl]-N-methyl-3-piperidin-1-ylpropanamide (PubChem CID 59036105) has the molecular formula C23H35N3O and a molecular weight of 369.55 g/mol. Its IUPAC name is N-[4-[(3R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]phenyl]-N-methyl-3-piperidin-1-ylpropanamide.
| Compound Name | N-[4-[(3R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]phenyl]-N-methyl-3-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 59036105 |
| Molecular Formula | C23H35N3O |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.28 |
| IUPAC Name | N-[4-[(3R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]phenyl]-N-methyl-3-piperidin-1-ylpropanamide |
| SMILES | CN(C(=O)CCN1CCCCC1)c1ccc([C@H]2CC[C@H]3CCCCN32)cc1 |
| InChI | InChI=1S/C23H35N3O/c1-24(23(27)14-18-25-15-4-2-5-16-25)20-10-8-19(9-11-20)22-13-12-21-7-3-6-17-26(21)22/h8-11,21-22H,2-7,12-18H2,1H3/t21-,22-/m1/s1 |
| InChIKey | RWNAWGRAKJEKAV-FGZHOGPDSA-N |
| XLogP | 4.21 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |