C13H17NO — CID 59036221
3-phenyl-1,2,5,6,7,8-hexahydropyrrolizin-3-ol (PubChem CID 59036221) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 3-phenyl-1,2,5,6,7,8-hexahydropyrrolizin-3-ol.
| Compound Name | 3-phenyl-1,2,5,6,7,8-hexahydropyrrolizin-3-ol |
|---|---|
| PubChem CID | 59036221 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 3-phenyl-1,2,5,6,7,8-hexahydropyrrolizin-3-ol |
| SMILES | OC1(c2ccccc2)CCC2CCCN21 |
| InChI | InChI=1S/C13H17NO/c15-13(11-5-2-1-3-6-11)9-8-12-7-4-10-14(12)13/h1-3,5-6,12,15H,4,7-10H2 |
| InChIKey | VWHMLOINWMXXAK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |