C13H22N4O4 — CID 59036323
ethyl (2R,3R,4S,5S,6S)-3-acetamido-6-(azidomethyl)-4,5-dimethyloxane-2-carboxylate (PubChem CID 59036323) has the molecular formula C13H22N4O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is ethyl (2R,3R,4S,5S,6S)-3-acetamido-6-(azidomethyl)-4,5-dimethyloxane-2-carboxylate.
| Compound Name | ethyl (2R,3R,4S,5S,6S)-3-acetamido-6-(azidomethyl)-4,5-dimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 59036323 |
| Molecular Formula | C13H22N4O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | ethyl (2R,3R,4S,5S,6S)-3-acetamido-6-(azidomethyl)-4,5-dimethyloxane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1O[C@H](CN=[N+]=[N-])[C@@H](C)[C@H](C)[C@H]1NC(C)=O |
| InChI | InChI=1S/C13H22N4O4/c1-5-20-13(19)12-11(16-9(4)18)8(3)7(2)10(21-12)6-15-17-14/h7-8,10-12H,5-6H2,1-4H3,(H,16,18)/t7-,8-,10+,11+,12+/m0/s1 |
| InChIKey | XHDGSIUFBLSZNY-VWNXEWBOSA-N |
| XLogP | 1.40 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|