C14H28O7Si — CID 59036350
methyl (3R,4S,5S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 59036350) has the molecular formula C14H28O7Si and a molecular weight of 336.46 g/mol. Its IUPAC name is methyl (3R,4S,5S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | methyl (3R,4S,5S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 59036350 |
| Molecular Formula | C14H28O7Si |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | methyl (3R,4S,5S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | COC(=O)C1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H28O7Si/c1-14(2,3)22(5,6)20-7-8-9(15)10(16)11(17)12(21-8)13(18)19-4/h8-12,15-17H,7H2,1-6H3/t8-,9-,10+,11-,12?/m1/s1 |
| InChIKey | SKAJLOXMZQGAOS-OZRWLHRGSA-N |
| XLogP | 0.03 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|