C9H16O7 — CID 59036373
ethyl (2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxylate (PubChem CID 59036373) has the molecular formula C9H16O7 and a molecular weight of 236.22 g/mol. Its IUPAC name is ethyl (2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxylate.
| Compound Name | ethyl (2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 59036373 |
| Molecular Formula | C9H16O7 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | ethyl (2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H16O7/c1-2-15-9(14)8-7(13)6(12)5(11)4(3-10)16-8/h4-8,10-13H,2-3H2,1H3/t4-,5-,6+,7-,8-/m1/s1 |
| InChIKey | YFAOATPTSZNQGQ-JAJWTYFOSA-N |
| XLogP | -2.61 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |