C28H30FNO6 — CID 59036404
(2R,3R,4R,5S,6R)-3-(fluoroamino)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylic acid (PubChem CID 59036404) has the molecular formula C28H30FNO6 and a molecular weight of 495.55 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-3-(fluoroamino)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylic acid.
| Compound Name | (2R,3R,4R,5S,6R)-3-(fluoroamino)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 59036404 |
| Molecular Formula | C28H30FNO6 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | (2R,3R,4R,5S,6R)-3-(fluoroamino)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1NF |
| InChI | InChI=1S/C28H30FNO6/c29-30-24-26(35-18-22-14-8-3-9-15-22)25(34-17-21-12-6-2-7-13-21)23(36-27(24)28(31)32)19-33-16-20-10-4-1-5-11-20/h1-15,23-27,30H,16-19H2,(H,31,32)/t23-,24-,25-,26-,27-/m1/s1 |
| InChIKey | FGWSCATWGAIIGZ-RFNQJFSXSA-N |
| XLogP | 4.07 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|