C23H41N3O6 — CID 59036500
ethyl (2R,3R,4S,5S,6S)-3-acetamido-6-[[[(2R,3R,4S,5S,6S)-6-(aminomethyl)-3,4,5-trimethyloxane-2-carbonyl]amino]methyl]-4,5-dimethyloxane-2-carboxylate (PubChem CID 59036500) has the molecular formula C23H41N3O6 and a molecular weight of 455.60 g/mol. Its IUPAC name is ethyl (2R,3R,4S,5S,6S)-3-acetamido-6-[[[(2R,3R,4S,5S,6S)-6-(aminomethyl)-3,4,5-trimethyloxane-2-carbonyl]amino]methyl]-4,5-dimethyloxane-2-carboxylate.
| Compound Name | ethyl (2R,3R,4S,5S,6S)-3-acetamido-6-[[[(2R,3R,4S,5S,6S)-6-(aminomethyl)-3,4,5-trimethyloxane-2-carbonyl]amino]methyl]-4,5-dimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 59036500 |
| Molecular Formula | C23H41N3O6 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.30 |
| IUPAC Name | ethyl (2R,3R,4S,5S,6S)-3-acetamido-6-[[[(2R,3R,4S,5S,6S)-6-(aminomethyl)-3,4,5-trimethyloxane-2-carbonyl]amino]methyl]-4,5-dimethyloxane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1O[C@H](CNC(=O)[C@@H]2O[C@H](CN)[C@@H](C)[C@H](C)[C@H]2C)[C@@H](C)[C@H](C)[C@H]1NC(C)=O |
| InChI | InChI=1S/C23H41N3O6/c1-8-30-23(29)21-19(26-16(7)27)14(5)13(4)18(32-21)10-25-22(28)20-15(6)11(2)12(3)17(9-24)31-20/h11-15,17-21H,8-10,24H2,1-7H3,(H,25,28)(H,26,27)/t11-,12-,13-,14-,15+,17+,18+,19+,20+,21+/m0/s1 |
| InChIKey | LMJWPLRDRYDJLI-MWIKYUIJSA-N |
| XLogP | 0.84 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |