About 8-O-ethyl 2-O-methyl 3-(4-trimethylstannylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate
8-O-ethyl 2-O-methyl 3-(4-trimethylstannylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate (PubChem CID 59036562) has the molecular formula C21H31NO4Sn
and a molecular weight of 480.19 g/mol. Its IUPAC name is 8-O-ethyl 2-O-methyl 3-(4-trimethylstannylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate.
Molecular Properties
| Compound Name | 8-O-ethyl 2-O-methyl 3-(4-trimethylstannylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate |
| PubChem CID | 59036562 |
| Molecular Formula | C21H31NO4Sn |
| Molecular Weight | 480.19 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 8-O-ethyl 2-O-methyl 3-(4-trimethylstannylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate |
| SMILES | CCOC(=O)N1C2CCC1C(C(=O)OC)C(c1ccc([Sn](C)(C)C)cc1)C2 |
| InChI | InChI=1S/C18H22NO4.3CH3.Sn/c1-3-23-18(21)19-13-9-10-15(19)16(17(20)22-2)14(11-13)12-7-5-4-6-8-12;;;;/h5-8,13-16H,3,9-11H2,1-2H3;3*1H3; |
| InChIKey | YNQFYFTVYDTJSZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.19 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-O-ethyl 2-O-methyl 3-(4-trimethylstannylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-O-ethyl 2-O-methyl 3-(4-trimethylstannylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate?
The IUPAC name of 8-O-ethyl 2-O-methyl 3-(4-trimethylstannylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate (CID 59036562) is 8-O-ethyl 2-O-methyl 3-(4-trimethylstannylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate.
What is the SMILES notation for 8-O-ethyl 2-O-methyl 3-(4-trimethylstannylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate?
The canonical SMILES for 8-O-ethyl 2-O-methyl 3-(4-trimethylstannylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate is CCOC(=O)N1C2CCC1C(C(=O)OC)C(c1ccc([Sn](C)(C)C)cc1)C2.
What is the InChIKey of 8-O-ethyl 2-O-methyl 3-(4-trimethylstannylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate?
The InChIKey is YNQFYFTVYDTJSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22NO4.3CH3.Sn/c1-3-23-18(21)19-13-9-10-15(19)16(17(20)22-2)14(11-13)12-7-5-4-6-8-12;;;;/h5-8,13-16H,3,9-11H2,1-2H3;3*1H3;.
What are the key properties of 8-O-ethyl 2-O-methyl 3-(4-trimethylstannylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate?
8-O-ethyl 2-O-methyl 3-(4-trimethylstannylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate has a molecular weight of 480.19 g/mol, XLogP of 3.50, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-O-ethyl 2-O-methyl 3-(4-trimethylstannylphenyl)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate is sourced from PubChem (CID 59036562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).