About 2,3-ditert-butyl-1-methyl-5-propyl-3,4-dihydro-2H-pyridine
2,3-ditert-butyl-1-methyl-5-propyl-3,4-dihydro-2H-pyridine (PubChem CID 59036723) has the molecular formula C17H33N
and a molecular weight of 251.46 g/mol. Its IUPAC name is 2,3-ditert-butyl-1-methyl-5-propyl-3,4-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 2,3-ditert-butyl-1-methyl-5-propyl-3,4-dihydro-2H-pyridine |
| PubChem CID | 59036723 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | 2,3-ditert-butyl-1-methyl-5-propyl-3,4-dihydro-2H-pyridine |
| SMILES | CCCC1=CN(C)C(C(C)(C)C)C(C(C)(C)C)C1 |
| InChI | InChI=1S/C17H33N/c1-9-10-13-11-14(16(2,3)4)15(17(5,6)7)18(8)12-13/h12,14-15H,9-11H2,1-8H3 |
| InChIKey | RRDQYHNFECZCGZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-ditert-butyl-1-methyl-5-propyl-3,4-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-ditert-butyl-1-methyl-5-propyl-3,4-dihydro-2H-pyridine?
The IUPAC name of 2,3-ditert-butyl-1-methyl-5-propyl-3,4-dihydro-2H-pyridine (CID 59036723) is 2,3-ditert-butyl-1-methyl-5-propyl-3,4-dihydro-2H-pyridine.
What is the SMILES notation for 2,3-ditert-butyl-1-methyl-5-propyl-3,4-dihydro-2H-pyridine?
The canonical SMILES for 2,3-ditert-butyl-1-methyl-5-propyl-3,4-dihydro-2H-pyridine is CCCC1=CN(C)C(C(C)(C)C)C(C(C)(C)C)C1.
What is the InChIKey of 2,3-ditert-butyl-1-methyl-5-propyl-3,4-dihydro-2H-pyridine?
The InChIKey is RRDQYHNFECZCGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33N/c1-9-10-13-11-14(16(2,3)4)15(17(5,6)7)18(8)12-13/h12,14-15H,9-11H2,1-8H3.
What are the key properties of 2,3-ditert-butyl-1-methyl-5-propyl-3,4-dihydro-2H-pyridine?
2,3-ditert-butyl-1-methyl-5-propyl-3,4-dihydro-2H-pyridine has a molecular weight of 251.46 g/mol, XLogP of 5.08, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-ditert-butyl-1-methyl-5-propyl-3,4-dihydro-2H-pyridine is sourced from PubChem (CID 59036723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).