About sodium dithiolane-3-carboxylate
sodium dithiolane-3-carboxylate (PubChem CID 59037046) has the molecular formula C4H5NaO2S2
and a molecular weight of 172.21 g/mol. Its IUPAC name is sodium dithiolane-3-carboxylate.
Molecular Properties
| Compound Name | sodium dithiolane-3-carboxylate |
| PubChem CID | 59037046 |
| Molecular Formula | C4H5NaO2S2 |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 171.96 |
| IUPAC Name | sodium dithiolane-3-carboxylate |
| SMILES | O=C([O-])C1CCSS1.[Na+] |
| InChI | InChI=1S/C4H6O2S2.Na/c5-4(6)3-1-2-7-8-3;/h3H,1-2H2,(H,5,6);/q;+1/p-1 |
| InChIKey | LEFVIYXRTPTLRH-UHFFFAOYSA-M |
| XLogP | -3.11 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze sodium dithiolane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium dithiolane-3-carboxylate?
The IUPAC name of sodium dithiolane-3-carboxylate (CID 59037046) is sodium dithiolane-3-carboxylate.
What is the SMILES notation for sodium dithiolane-3-carboxylate?
The canonical SMILES for sodium dithiolane-3-carboxylate is O=C([O-])C1CCSS1.[Na+].
What is the InChIKey of sodium dithiolane-3-carboxylate?
The InChIKey is LEFVIYXRTPTLRH-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6O2S2.Na/c5-4(6)3-1-2-7-8-3;/h3H,1-2H2,(H,5,6);/q;+1/p-1.
What are the key properties of sodium dithiolane-3-carboxylate?
sodium dithiolane-3-carboxylate has a molecular weight of 172.21 g/mol, XLogP of -3.11, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium dithiolane-3-carboxylate is sourced from PubChem (CID 59037046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).