C27H28ClFN4O — CID 59037402
3-(3-chloro-4-fluorophenyl)-1-[4-(3-cyanophenyl)phenyl]-1-[3-(diethylamino)propyl]urea (PubChem CID 59037402) has the molecular formula C27H28ClFN4O and a molecular weight of 479.00 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-1-[4-(3-cyanophenyl)phenyl]-1-[3-(diethylamino)propyl]urea.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-1-[4-(3-cyanophenyl)phenyl]-1-[3-(diethylamino)propyl]urea |
|---|---|
| PubChem CID | 59037402 |
| Molecular Formula | C27H28ClFN4O |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-1-[4-(3-cyanophenyl)phenyl]-1-[3-(diethylamino)propyl]urea |
| SMILES | CCN(CC)CCCN(C(=O)Nc1ccc(F)c(Cl)c1)c1ccc(-c2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C27H28ClFN4O/c1-3-32(4-2)15-6-16-33(27(34)31-23-11-14-26(29)25(28)18-23)24-12-9-21(10-13-24)22-8-5-7-20(17-22)19-30/h5,7-14,17-18H,3-4,6,15-16H2,1-2H3,(H,31,34) |
| InChIKey | MSUFFCYDAQVZAR-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |