C31H62 — CID 59037493
1-ethyl-1,2,2,4,4,6,6-heptapropylcyclooctane (PubChem CID 59037493) has the molecular formula C31H62 and a molecular weight of 434.84 g/mol. Its IUPAC name is 1-ethyl-1,2,2,4,4,6,6-heptapropylcyclooctane.
| Compound Name | 1-ethyl-1,2,2,4,4,6,6-heptapropylcyclooctane |
|---|---|
| PubChem CID | 59037493 |
| Molecular Formula | C31H62 |
| Molecular Weight | 434.84 g/mol |
| Exact Mass | 434.49 |
| IUPAC Name | 1-ethyl-1,2,2,4,4,6,6-heptapropylcyclooctane |
| SMILES | CCCC1(CCC)CCC(CC)(CCC)C(CCC)(CCC)CC(CCC)(CCC)C1 |
| InChI | InChI=1S/C31H62/c1-9-17-28(18-10-2)24-25-30(16-8,21-13-5)31(22-14-6,23-15-7)27-29(26-28,19-11-3)20-12-4/h9-27H2,1-8H3 |
| InChIKey | GIFLXSCIALWJIX-UHFFFAOYSA-N |
| XLogP | 11.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.84 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |