About (6R)-2,6,8-trimethyl-7-propan-2-ylnonan-2-ol
(6R)-2,6,8-trimethyl-7-propan-2-ylnonan-2-ol (PubChem CID 59038713) has the molecular formula C15H32O
and a molecular weight of 228.42 g/mol. Its IUPAC name is (6R)-2,6,8-trimethyl-7-propan-2-ylnonan-2-ol.
Molecular Properties
| Compound Name | (6R)-2,6,8-trimethyl-7-propan-2-ylnonan-2-ol |
| PubChem CID | 59038713 |
| Molecular Formula | C15H32O |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.25 |
| IUPAC Name | (6R)-2,6,8-trimethyl-7-propan-2-ylnonan-2-ol |
| SMILES | CC(C)C(C(C)C)[C@H](C)CCCC(C)(C)O |
| InChI | InChI=1S/C15H32O/c1-11(2)14(12(3)4)13(5)9-8-10-15(6,7)16/h11-14,16H,8-10H2,1-7H3/t13-/m1/s1 |
| InChIKey | PZFJGHFRNGVHEW-CYBMUJFWSA-N |
| XLogP | 4.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6R)-2,6,8-trimethyl-7-propan-2-ylnonan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-2,6,8-trimethyl-7-propan-2-ylnonan-2-ol?
The IUPAC name of (6R)-2,6,8-trimethyl-7-propan-2-ylnonan-2-ol (CID 59038713) is (6R)-2,6,8-trimethyl-7-propan-2-ylnonan-2-ol.
What is the SMILES notation for (6R)-2,6,8-trimethyl-7-propan-2-ylnonan-2-ol?
The canonical SMILES for (6R)-2,6,8-trimethyl-7-propan-2-ylnonan-2-ol is CC(C)C(C(C)C)[C@H](C)CCCC(C)(C)O.
What is the InChIKey of (6R)-2,6,8-trimethyl-7-propan-2-ylnonan-2-ol?
The InChIKey is PZFJGHFRNGVHEW-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H32O/c1-11(2)14(12(3)4)13(5)9-8-10-15(6,7)16/h11-14,16H,8-10H2,1-7H3/t13-/m1/s1.
What are the key properties of (6R)-2,6,8-trimethyl-7-propan-2-ylnonan-2-ol?
(6R)-2,6,8-trimethyl-7-propan-2-ylnonan-2-ol has a molecular weight of 228.42 g/mol, XLogP of 4.49, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-2,6,8-trimethyl-7-propan-2-ylnonan-2-ol is sourced from PubChem (CID 59038713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).