C21H27Zr — CID 59039635
1-[2-(2,3,3a,7a-tetrahydro-1H-inden-2-id-1-yl)ethyl]-2,3,3a,7a-tetrahydro-1H-inden-2-ide;carbanide;zirconium(3+) (PubChem CID 59039635) has the molecular formula C21H27Zr and a molecular weight of 370.67 g/mol. Its IUPAC name is 1-[2-(2,3,3a,7a-tetrahydro-1H-inden-2-id-1-yl)ethyl]-2,3,3a,7a-tetrahydro-1H-inden-2-ide;carbanide;zirconium(3+).
| Compound Name | 1-[2-(2,3,3a,7a-tetrahydro-1H-inden-2-id-1-yl)ethyl]-2,3,3a,7a-tetrahydro-1H-inden-2-ide;carbanide;zirconium(3+) |
|---|---|
| PubChem CID | 59039635 |
| Molecular Formula | C21H27Zr |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 1-[2-(2,3,3a,7a-tetrahydro-1H-inden-2-id-1-yl)ethyl]-2,3,3a,7a-tetrahydro-1H-inden-2-ide;carbanide;zirconium(3+) |
| SMILES | C1=CC2C[CH-]C(CCC3[CH-]CC4C=CC=CC43)C2C=C1.[CH3-].[Zr+3] |
| InChI | InChI=1S/C20H24.CH3.Zr/c1-3-7-19-15(5-1)9-11-17(19)13-14-18-12-10-16-6-2-4-8-20(16)18;;/h1-8,11-12,15-20H,9-10,13-14H2;1H3;/q-2;-1;+3 |
| InChIKey | PDEPMHBCXICEHJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|