C17H11F5O3 — CID 59039923
[4-(trifluoromethoxy)phenyl] (E)-2,3-difluoro-3-(4-methylphenyl)prop-2-enoate (PubChem CID 59039923) has the molecular formula C17H11F5O3 and a molecular weight of 358.26 g/mol. Its IUPAC name is [4-(trifluoromethoxy)phenyl] (E)-2,3-difluoro-3-(4-methylphenyl)prop-2-enoate.
| Compound Name | [4-(trifluoromethoxy)phenyl] (E)-2,3-difluoro-3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 59039923 |
| Molecular Formula | C17H11F5O3 |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | [4-(trifluoromethoxy)phenyl] (E)-2,3-difluoro-3-(4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(/C(F)=C(\F)C(=O)Oc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H11F5O3/c1-10-2-4-11(5-3-10)14(18)15(19)16(23)24-12-6-8-13(9-7-12)25-17(20,21)22/h2-9H,1H3/b15-14+ |
| InChIKey | RLTGYHHMPHIVLJ-CCEZHUSRSA-N |
| XLogP | 5.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|