C22H30N2O8 — CID 59040220
[(3S,6S,7R,8R)-3-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]-8-ethyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate (PubChem CID 59040220) has the molecular formula C22H30N2O8 and a molecular weight of 450.49 g/mol. Its IUPAC name is [(3S,6S,7R,8R)-3-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]-8-ethyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate.
| Compound Name | [(3S,6S,7R,8R)-3-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]-8-ethyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 59040220 |
| Molecular Formula | C22H30N2O8 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | [(3S,6S,7R,8R)-3-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]-8-ethyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| SMILES | CC[C@H]1C(=O)OC[C@H](NC(=O)c2c(C)cc(C)[nH]c2=O)C(=O)O[C@@H](C)[C@@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C22H30N2O8/c1-7-14-17(32-20(27)10(2)3)13(6)31-22(29)15(9-30-21(14)28)24-19(26)16-11(4)8-12(5)23-18(16)25/h8,10,13-15,17H,7,9H2,1-6H3,(H,23,25)(H,24,26)/t13-,14+,15-,17-/m0/s1 |
| InChIKey | NYAKPKVWHAGDAE-IVSAIRAKSA-N |
| XLogP | 1.17 |
| TPSA | 140.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|