C26H39N5O3 — CID 59040982
ethyl N-[N-[(2S)-1-[(4-cyano-1-propylpiperidin-4-yl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-phenylcarbonimidoyl]carbamate (PubChem CID 59040982) has the molecular formula C26H39N5O3 and a molecular weight of 469.63 g/mol. Its IUPAC name is ethyl N-[N-[(2S)-1-[(4-cyano-1-propylpiperidin-4-yl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-phenylcarbonimidoyl]carbamate.
| Compound Name | ethyl N-[N-[(2S)-1-[(4-cyano-1-propylpiperidin-4-yl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-phenylcarbonimidoyl]carbamate |
|---|---|
| PubChem CID | 59040982 |
| Molecular Formula | C26H39N5O3 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.31 |
| IUPAC Name | ethyl N-[N-[(2S)-1-[(4-cyano-1-propylpiperidin-4-yl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-phenylcarbonimidoyl]carbamate |
| SMILES | CCCN1CCC(C#N)(NC(=O)[C@H](CC(C)(C)C)/N=C(\NC(=O)OCC)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H39N5O3/c1-6-15-31-16-13-26(19-27,14-17-31)30-23(32)21(18-25(3,4)5)28-22(29-24(33)34-7-2)20-11-9-8-10-12-20/h8-12,21H,6-7,13-18H2,1-5H3,(H,30,32)(H,28,29,33)/t21-/m0/s1 |
| InChIKey | MMXZMERDSYTTLW-NRFANRHFSA-N |
| XLogP | 3.87 |
| TPSA | 106.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|