C36H39F3N5+ — CID 59041198
1,3-dibutyl-2-[3-[1,1-dimethyl-3-(2,2,2-trifluoroethyl)benzo[e]indol-2-ylidene]prop-1-enyl]imidazo[4,5-b]quinoxalin-3-ium (PubChem CID 59041198) has the molecular formula C36H39F3N5+ and a molecular weight of 598.74 g/mol. Its IUPAC name is 1,3-dibutyl-2-[3-[1,1-dimethyl-3-(2,2,2-trifluoroethyl)benzo[e]indol-2-ylidene]prop-1-enyl]imidazo[4,5-b]quinoxalin-3-ium.
| Compound Name | 1,3-dibutyl-2-[3-[1,1-dimethyl-3-(2,2,2-trifluoroethyl)benzo[e]indol-2-ylidene]prop-1-enyl]imidazo[4,5-b]quinoxalin-3-ium |
|---|---|
| PubChem CID | 59041198 |
| Molecular Formula | C36H39F3N5+ |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.32 |
| IUPAC Name | 1,3-dibutyl-2-[3-[1,1-dimethyl-3-(2,2,2-trifluoroethyl)benzo[e]indol-2-ylidene]prop-1-enyl]imidazo[4,5-b]quinoxalin-3-ium |
| SMILES | CCCCn1c(C=CC=C2N(CC(F)(F)F)c3ccc4ccccc4c3C2(C)C)[n+](CCCC)c2nc3ccccc3nc21 |
| InChI | InChI=1S/C36H39F3N5/c1-5-7-22-42-31(43(23-8-6-2)34-33(42)40-27-16-11-12-17-28(27)41-34)19-13-18-30-35(3,4)32-26-15-10-9-14-25(26)20-21-29(32)44(30)24-36(37,38)39/h9-21H,5-8,22-24H2,1-4H3/q+1 |
| InChIKey | MZFQHOPXFUPEHL-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|