C18H26O5 — CID 59041435
(3aR,6R,6aR)-3-[(4-pentylphenyl)peroxymethyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol (PubChem CID 59041435) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is (3aR,6R,6aR)-3-[(4-pentylphenyl)peroxymethyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol.
| Compound Name | (3aR,6R,6aR)-3-[(4-pentylphenyl)peroxymethyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
|---|---|
| PubChem CID | 59041435 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | (3aR,6R,6aR)-3-[(4-pentylphenyl)peroxymethyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
| SMILES | CCCCCc1ccc(OOCC2CO[C@@H]3[C@H](O)CO[C@H]23)cc1 |
| InChI | InChI=1S/C18H26O5/c1-2-3-4-5-13-6-8-15(9-7-13)23-22-11-14-10-20-18-16(19)12-21-17(14)18/h6-9,14,16-19H,2-5,10-12H2,1H3/t14?,16-,17-,18-/m1/s1 |
| InChIKey | BLVRKLYCEVFDTA-UDFCOPTFSA-N |
| XLogP | 2.50 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|