C17H23F5OY — CID 59042277
2-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-1,1,1,3,3-pentafluoropropan-2-ol;yttrium (PubChem CID 59042277) has the molecular formula C17H23F5OY and a molecular weight of 427.27 g/mol. Its IUPAC name is 2-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-1,1,1,3,3-pentafluoropropan-2-ol;yttrium.
| Compound Name | 2-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-1,1,1,3,3-pentafluoropropan-2-ol;yttrium |
|---|---|
| PubChem CID | 59042277 |
| Molecular Formula | C17H23F5OY |
| Molecular Weight | 427.27 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 2-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-1,1,1,3,3-pentafluoropropan-2-ol;yttrium |
| SMILES | CC1C(C)C2CC1C1C3CC(C21)C(C(O)(C(F)F)C(F)(F)F)C3.[Y] |
| InChI | InChI=1S/C17H23F5O.Y/c1-6-7(2)10-5-9(6)13-8-3-11(14(10)13)12(4-8)16(23,15(18)19)17(20,21)22;/h6-15,23H,3-5H2,1-2H3; |
| InChIKey | SRFQQPRYQXQSEL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.27 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|