C32H54O — CID 59042363
3a-(2-methoxyethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene (PubChem CID 59042363) has the molecular formula C32H54O and a molecular weight of 454.78 g/mol. Its IUPAC name is 3a-(2-methoxyethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene.
| Compound Name | 3a-(2-methoxyethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene |
|---|---|
| PubChem CID | 59042363 |
| Molecular Formula | C32H54O |
| Molecular Weight | 454.78 g/mol |
| Exact Mass | 454.42 |
| IUPAC Name | 3a-(2-methoxyethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene |
| SMILES | C=C(C)C1CCC2(CCOC)CCC3(C)C(CCC4C5(C)CCCC(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C32H54O/c1-22(2)23-12-17-32(20-21-33-8)19-18-30(6)24(27(23)32)10-11-26-29(5)15-9-14-28(3,4)25(29)13-16-31(26,30)7/h23-27H,1,9-21H2,2-8H3 |
| InChIKey | KDSNLWJCQJMEKG-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.78 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|