C21H23BBrClN2O3 — CID 59042592
(2R)-4-(6-bromo-13-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)-1-[hydroxy(methyl)boranyl]piperazine-2-carboxylic acid (PubChem CID 59042592) has the molecular formula C21H23BBrClN2O3 and a molecular weight of 477.60 g/mol. Its IUPAC name is (2R)-4-(6-bromo-13-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)-1-[hydroxy(methyl)boranyl]piperazine-2-carboxylic acid.
| Compound Name | (2R)-4-(6-bromo-13-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)-1-[hydroxy(methyl)boranyl]piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 59042592 |
| Molecular Formula | C21H23BBrClN2O3 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | (2R)-4-(6-bromo-13-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)-1-[hydroxy(methyl)boranyl]piperazine-2-carboxylic acid |
| SMILES | CB(O)N1CCN(C2c3ccc(Cl)cc3CCc3cc(Br)ccc32)C[C@@H]1C(=O)O |
| InChI | InChI=1S/C21H23BBrClN2O3/c1-22(29)26-9-8-25(12-19(26)21(27)28)20-17-6-4-15(23)10-13(17)2-3-14-11-16(24)5-7-18(14)20/h4-7,10-11,19-20,29H,2-3,8-9,12H2,1H3,(H,27,28)/t19-,20?/m1/s1 |
| InChIKey | MPRAXGKLSLISLF-FIWHBWSRSA-N |
| XLogP | 3.47 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|