C29H29N3O — CID 59042749
(Z,4Z)-4-[(E,4Z)-4-(3-butyl-5-methyl-1,3-benzoxazol-2-ylidene)but-2-enylidene]-2-methyl-3-(4-methylphenyl)pent-2-enedinitrile (PubChem CID 59042749) has the molecular formula C29H29N3O and a molecular weight of 435.57 g/mol. Its IUPAC name is (Z,4Z)-4-[(E,4Z)-4-(3-butyl-5-methyl-1,3-benzoxazol-2-ylidene)but-2-enylidene]-2-methyl-3-(4-methylphenyl)pent-2-enedinitrile.
| Compound Name | (Z,4Z)-4-[(E,4Z)-4-(3-butyl-5-methyl-1,3-benzoxazol-2-ylidene)but-2-enylidene]-2-methyl-3-(4-methylphenyl)pent-2-enedinitrile |
|---|---|
| PubChem CID | 59042749 |
| Molecular Formula | C29H29N3O |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | (Z,4Z)-4-[(E,4Z)-4-(3-butyl-5-methyl-1,3-benzoxazol-2-ylidene)but-2-enylidene]-2-methyl-3-(4-methylphenyl)pent-2-enedinitrile |
| SMILES | CCCCN1/C(=C/C=C/C=C(C#N)/C(=C(/C)C#N)c2ccc(C)cc2)Oc2ccc(C)cc21 |
| InChI | InChI=1S/C29H29N3O/c1-5-6-17-32-26-18-22(3)13-16-27(26)33-28(32)10-8-7-9-25(20-31)29(23(4)19-30)24-14-11-21(2)12-15-24/h7-16,18H,5-6,17H2,1-4H3/b8-7+,25-9+,28-10-,29-23- |
| InChIKey | VVNWHBJVQCNGHD-SIODOKIKSA-N |
| XLogP | 7.15 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|