C20H36O5 — CID 59042859
(6R,8R,8aR)-6-[(3R,4R,6S)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-2,7,8-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 59042859) has the molecular formula C20H36O5 and a molecular weight of 356.50 g/mol. Its IUPAC name is (6R,8R,8aR)-6-[(3R,4R,6S)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-2,7,8-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (6R,8R,8aR)-6-[(3R,4R,6S)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-2,7,8-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 59042859 |
| Molecular Formula | C20H36O5 |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | (6R,8R,8aR)-6-[(3R,4R,6S)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-2,7,8-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CCC1O[C@@H](C)C(C)[C@@H](C)[C@H]1O[C@@H]1OC2COC(C)O[C@@H]2[C@H](C)C1C |
| InChI | InChI=1S/C20H36O5/c1-8-16-18(11(3)10(2)14(6)22-16)25-20-13(5)12(4)19-17(24-20)9-21-15(7)23-19/h10-20H,8-9H2,1-7H3/t10?,11-,12-,13?,14+,15?,16?,17?,18-,19-,20+/m1/s1 |
| InChIKey | LUTREPKTKTXVCX-FKWRGXTGSA-N |
| XLogP | 3.60 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |