C21H38O5 — CID 59042866
(6R,8S,8aR)-6-[(3S,6R)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-2,2,7,8-tetramethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 59042866) has the molecular formula C21H38O5 and a molecular weight of 370.53 g/mol. Its IUPAC name is (6R,8S,8aR)-6-[(3S,6R)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-2,2,7,8-tetramethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (6R,8S,8aR)-6-[(3S,6R)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-2,2,7,8-tetramethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 59042866 |
| Molecular Formula | C21H38O5 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | (6R,8S,8aR)-6-[(3S,6R)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-2,2,7,8-tetramethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CCC1O[C@H](C)C(C)C(C)[C@@H]1O[C@@H]1OC2COC(C)(C)O[C@@H]2[C@@H](C)C1C |
| InChI | InChI=1S/C21H38O5/c1-9-16-18(12(3)11(2)15(6)23-16)25-20-14(5)13(4)19-17(24-20)10-22-21(7,8)26-19/h11-20H,9-10H2,1-8H3/t11?,12?,13-,14?,15+,16?,17?,18-,19+,20-/m0/s1 |
| InChIKey | SWDCNZXFMHMOKL-KXNZOCQDSA-N |
| XLogP | 3.99 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |