C12H14N2O3S2 — CID 59043001
6-tert-butyl-7-(tritiooxydisulfanyl)-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 59043001) has the molecular formula C12H14N2O3S2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 6-tert-butyl-7-(tritiooxydisulfanyl)-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-tert-butyl-7-(tritiooxydisulfanyl)-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 59043001 |
| Molecular Formula | C12H14N2O3S2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 6-tert-butyl-7-(tritiooxydisulfanyl)-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | [3H]OSSc1cc2[nH]c(=O)c(=O)[nH]c2cc1C(C)(C)C |
| InChI | InChI=1S/C12H14N2O3S2/c1-12(2,3)6-4-7-8(5-9(6)18-19-17)14-11(16)10(15)13-7/h4-5,17H,1-3H3,(H,13,15)(H,14,16)/i/hT |
| InChIKey | BFTVJYLYPNNUBE-MNYXATJNSA-N |
| XLogP | 2.73 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|