C12H18F3ORf- — CID 59043251
3-(1,4-dimethyl-2-bicyclo[2.2.1]heptanyl)-1,1,1-trifluoropropan-2-ol;rutherfordium (PubChem CID 59043251) has the molecular formula C12H18F3ORf- and a molecular weight of 502.27 g/mol. Its IUPAC name is 3-(1,4-dimethyl-2-bicyclo[2.2.1]heptanyl)-1,1,1-trifluoropropan-2-ol;rutherfordium.
| Compound Name | 3-(1,4-dimethyl-2-bicyclo[2.2.1]heptanyl)-1,1,1-trifluoropropan-2-ol;rutherfordium |
|---|---|
| PubChem CID | 59043251 |
| Molecular Formula | C12H18F3ORf- |
| Molecular Weight | 502.27 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | 3-(1,4-dimethyl-2-bicyclo[2.2.1]heptanyl)-1,1,1-trifluoropropan-2-ol;rutherfordium |
| SMILES | CC12CCC(C)(C1)C(C[C-](O)C(F)(F)F)C2.[Rf] |
| InChI | InChI=1S/C12H18F3O.Rf/c1-10-3-4-11(2,7-10)8(6-10)5-9(16)12(13,14)15;/h8,16H,3-7H2,1-2H3;/q-1; |
| InChIKey | ZLZIAKRKLBWQQH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.27 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|