C15H15O8- — CID 59043311
5-[3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)prop-1-enyl]-2,2-dimethyl-6-oxo-1,3-dioxin-4-olate (PubChem CID 59043311) has the molecular formula C15H15O8- and a molecular weight of 323.28 g/mol. Its IUPAC name is 5-[3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)prop-1-enyl]-2,2-dimethyl-6-oxo-1,3-dioxin-4-olate.
| Compound Name | 5-[3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)prop-1-enyl]-2,2-dimethyl-6-oxo-1,3-dioxin-4-olate |
|---|---|
| PubChem CID | 59043311 |
| Molecular Formula | C15H15O8- |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 5-[3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)prop-1-enyl]-2,2-dimethyl-6-oxo-1,3-dioxin-4-olate |
| SMILES | CC1(C)OC(=O)C(=CC=CC2=C([O-])OC(C)(C)OC2=O)C(=O)O1 |
| InChI | InChI=1S/C15H16O8/c1-14(2)20-10(16)8(11(17)21-14)6-5-7-9-12(18)22-15(3,4)23-13(9)19/h5-7,16H,1-4H3/p-1 |
| InChIKey | HDPKNZNZFWYAIJ-UHFFFAOYSA-M |
| XLogP | 0.19 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|