C20H32NOY- — CID 59043407
5-[3-[(1R,7aR)-4-methanidylidene-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-methylpyrrolidin-2-one;yttrium (PubChem CID 59043407) has the molecular formula C20H32NOY- and a molecular weight of 391.39 g/mol. Its IUPAC name is 5-[3-[(1R,7aR)-4-methanidylidene-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-methylpyrrolidin-2-one;yttrium.
| Compound Name | 5-[3-[(1R,7aR)-4-methanidylidene-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-methylpyrrolidin-2-one;yttrium |
|---|---|
| PubChem CID | 59043407 |
| Molecular Formula | C20H32NOY- |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 5-[3-[(1R,7aR)-4-methanidylidene-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-methylpyrrolidin-2-one;yttrium |
| SMILES | [H]/[C-]=C1/CCC[C@@]2(C)C1CC[C@@H]2C(C)CCC1CC(C)C(=O)N1.[Y] |
| InChI | InChI=1S/C20H32NO.Y/c1-13-6-5-11-20(4)17(13)9-10-18(20)14(2)7-8-16-12-15(3)19(22)21-16;/h1,14-18H,5-12H2,2-4H3,(H,21,22);/q-1;/t14?,15?,16?,17?,18-,20+;/m1./s1 |
| InChIKey | AFGBTZJKOKYYQN-CQUIFFLTSA-N |
| XLogP | 4.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|