C20H33BrO2 — CID 59043458
(3R,7R)-7-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-hydroxy-3-methyloctan-2-one (PubChem CID 59043458) has the molecular formula C20H33BrO2 and a molecular weight of 385.39 g/mol. Its IUPAC name is (3R,7R)-7-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-hydroxy-3-methyloctan-2-one.
| Compound Name | (3R,7R)-7-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-hydroxy-3-methyloctan-2-one |
|---|---|
| PubChem CID | 59043458 |
| Molecular Formula | C20H33BrO2 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | (3R,7R)-7-[(1R,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-hydroxy-3-methyloctan-2-one |
| SMILES | CC(=O)[C@](C)(O)CCC[C@@H](C)[C@H]1CCC2/C(=C/Br)CCC[C@@]21C |
| InChI | InChI=1S/C20H33BrO2/c1-14(7-5-12-20(4,23)15(2)22)17-9-10-18-16(13-21)8-6-11-19(17,18)3/h13-14,17-18,23H,5-12H2,1-4H3/b16-13+/t14-,17-,18?,19-,20-/m1/s1 |
| InChIKey | RLAPPTGWBUVMSO-OHMHDZNVSA-N |
| XLogP | 5.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |